Atomoxetine Impurity 37

INQUIRY Add to cart

For Research Use Only | Not For Clinical Use

CAT	APB2659259659
CAS	2659259-65-9
Synonyms	N-(3-hydroxy-3-phenylpropyl)-N-methylnitrous amide
Molecular Weight	194.11
Molecular Formula	C10H14N2O2

What is the product name of CAS 2659259-65-9?

The product name is Atomoxetine Impurity 37.

What is the molecular weight of Atomoxetine Impurity 37?

The molecular weight is 194.11.

What is the molecular formula of Atomoxetine Impurity 37?

The molecular formula is C10H14N2O2.

What is the synonym for Atomoxetine Impurity 37?

The synonym is N-(3-hydroxy-3-phenylpropyl)-N-methylnitrous amide.

What is the chemical structure of Atomoxetine Impurity 37?

The chemical structure is C-C-C-C-C-C-N-C-C-N(=O)-OH.

What is the key ingredient in Atomoxetine Impurity 37?

The key ingredient is N-methylnitrous amide.

How many carbon atoms are present in the molecular formula of Atomoxetine Impurity 37?

There are 10 carbon atoms in the molecular formula.

What is the role of Atomoxetine Impurity 37 in relation to Atomoxetine?

Atomoxetine Impurity 37 is a chemical impurity associated with the drug Atomoxetine.

How can Atomoxetine Impurity 37 be synthesized?

Atomoxetine Impurity 37 can be synthesized by combining specific chemical compounds in a laboratory setting.

Why is it important to identify and characterize impurities like Atomoxetine Impurity 37 in pharmaceutical products?

It is important to identify and characterize impurities like Atomoxetine Impurity 37 in pharmaceutical products to ensure product safety, efficacy, and regulatory compliance.

* Products or Services Interested: Atomoxetine Impurity 37 (2659259-65-9)
* Your question
* Name
* Email
Verification Code

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry