Brivaracetam Impurity 68

INQUIRY Add to cart

For Research Use Only | Not For Clinical Use

CAT	APB03380
Synonyms	(2S)-2-(2-hydroxy-5-oxo-3-propyl-2,5-dihydro-1H-pyrrol-1-yl)butanamide
Molecular Weight	226.27
Molecular Formula	C11H18N2O3

What is the molecular weight of Brivaracetam Impurity 68?

The molecular weight of Brivaracetam Impurity 68 is 226.27.

What is the molecular formula of Brivaracetam Impurity 68?

The molecular formula of Brivaracetam Impurity 68 is C11H18N2O3.

What is an other name for Brivaracetam Impurity 68?

An other name for Brivaracetam Impurity 68 is (2S)-2-(2-hydroxy-5-oxo-3-propyl-2,5-dihydro-1H-pyrrol-1-yl)butanamide.

Can you provide the chemical structure of Brivaracetam Impurity 68?

The chemical structure of Brivaracetam Impurity 68 is CCCC(C1=CC(NC1=O)O)C(=O)N.

What is the role of Brivaracetam Impurity 68?

Brivaracetam Impurity 68 is an impurity in the synthesis of the drug Brivaracetam.

How does Brivaracetam Impurity 68 affect the purity of the final pharmaceutical product?

Brivaracetam Impurity 68 can affect the purity of the final pharmaceutical product if present in high levels, leading to potential safety and efficacy concerns.

Is Brivaracetam Impurity 68 a common impurity found in the manufacturing process of Brivaracetam?

Brivaracetam Impurity 68 is a specific impurity that can be found in the manufacturing process of Brivaracetam.

How is Brivaracetam Impurity 68 detected and quantified during the manufacturing process?

Analytical methods such as HPLC (High Performance Liquid Chromatography) are used to detect and quantify Brivaracetam Impurity 68 during the manufacturing process.

What are the potential risks associated with the presence of Brivaracetam Impurity 68 in the final pharmaceutical product?

The presence of Brivaracetam Impurity 68 in high levels can pose risks to patient safety and drug efficacy, necessitating strict control measures during the manufacturing process.

Why is it important for pharmaceutical manufacturers to monitor and control impurities like Brivaracetam Impurity 68 during drug synthesis?

Monitoring and controlling impurities such as Brivaracetam Impurity 68 is crucial for ensuring the quality, safety, and efficacy of the final pharmaceutical product.

* Products or Services Interested: Brivaracetam Impurity 68 ()
* Your question
* Name
* Email
Verification Code

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry