Crisaborole Impurity 4

INQUIRY Add to cart

For Research Use Only | Not For Clinical Use

CAT	APB888967633
CAS	888967-63-3
Synonyms	4-(3-(hydroxymethyl)phenoxy)benzonitrile
Molecular Weight	225.24
Molecular Formula	C14H11NO2

What is the product name of CAS 888967-63-3?

The product name is Crisaborole Impurity 4.

What is the molecular weight of Crisaborole Impurity 4?

The molecular weight is 225.24.

What is the molecular formula of Crisaborole Impurity 4?

The molecular formula is C14H11NO2.

What is the synonym of Crisaborole Impurity 4?

The synonym is 4-(3-(hydroxymethyl)phenoxy)benzonitrile.

What is the chemical structure of Crisaborole Impurity 4?

The chemical structure is C6H2(C(CN)(OH))O(C1C=CC=C(C=1)).

How is Crisaborole Impurity 4 commonly used?

It is used as an impurity reference standard in pharmaceutical research and development.

What is the role of Crisaborole Impurity 4 in pharmaceutical quality control?

It is used to ensure the purity and consistency of Crisaborole in pharmaceutical formulations.

How is Crisaborole Impurity 4 synthesized?

It can be synthesized through a series of chemical reactions starting from appropriate precursors.

What are the potential impurities that may be present in Crisaborole formulations?

Impurities such as Crisaborole Impurity 1, Crisaborole Impurity 2, and Crisaborole Impurity 3 may be present.

How can Crisaborole Impurity 4 be detected and quantified in pharmaceutical samples?

It can be detected and quantified using analytical techniques such as HPLC or GC-MS.

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry