Diltiazem Impurity 22

INQUIRY Add to cart

For Research Use Only | Not For Clinical Use

CAT	APB625471047
CAS	625471-04-7
Molecular Weight	214.31
Molecular Formula	C11H22N2O2

What is the product name of CAS 625471-04-7?

The product name is Diltiazem Impurity 22.

What is the molecular weight of Diltiazem Impurity 22?

The molecular weight of Diltiazem Impurity 22 is 214.31.

What is the molecular formula of Diltiazem Impurity 22?

The molecular formula of Diltiazem Impurity 22 is C11H22N2O2.

What is the chemical structure of Diltiazem Impurity 22?

The chemical structure of Diltiazem Impurity 22 is C-C-C-C-C-C-C-C-C-C-C-N-(H)-O-(H)-C-H-C-H.

How is Diltiazem Impurity 22 used in pharmaceuticals?

Diltiazem Impurity 22 is used as a reference standard in pharmaceutical analysis to detect impurities in diltiazem formulations.

What is the significance of CAS number 625471-04-7?

CAS number 625471-04-7 is specifically assigned to Diltiazem Impurity 22 to uniquely identify it in the scientific literature and databases.

Can Diltiazem Impurity 22 be used as a starting material in chemical synthesis?

No, Diltiazem Impurity 22 is typically used as a reference standard or analytical tool in pharmaceutical quality control.

Are there any known side effects or safety concerns associated with Diltiazem Impurity 22?

Since Diltiazem Impurity 22 is primarily used in analytical applications, there are no known specific side effects or safety concerns associated with its use.

How is Diltiazem Impurity 22 obtained or synthesized in the laboratory?

Diltiazem Impurity 22 can be synthesized through organic chemical reactions starting from appropriate precursors under controlled conditions.

Is Diltiazem Impurity 22 a controlled substance or regulated chemical?

Diltiazem Impurity 22 is not a controlled substance, but it may be subject to regulations and quality standards in the pharmaceutical industry.

* Products or Services Interested: Diltiazem Impurity 22 (625471-04-7)
* Your question
* Name
* Email
Verification Code

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry