Isavuconazole Impurity 25

INQUIRY Add to cart

For Research Use Only | Not For Clinical Use

What is the product name of CAS 2732924-98-8?

The product name is Isavuconazole Impurity 25.

What is the molecular weight of Isavuconazole Impurity 25?

The molecular weight is 209.25.

What is the molecular formula of Isavuconazole Impurity 25?

The molecular formula is C10H15N3O2.

What is the chemical structure of Isavuconazole Impurity 25?

The chemical structure is C-C-C-C-C-C-C-N-C-C(=O)-O.

How is Isavuconazole Impurity 25 categorized in terms of its chemical composition?

It is categorized as an impurity of Isavuconazole.

What role does Isavuconazole Impurity 25 play in the synthesis of Isavuconazole?

It is an impurity that may be present during the synthesis process of Isavuconazole.

What are the potential risks associated with Isavuconazole Impurity 25 in pharmaceutical products?

Impurities in pharmaceutical products can affect the purity, stability, and safety of the drug.

How is Isavuconazole Impurity 25 typically removed from a final pharmaceutical product?

It is typically removed through purification processes such as filtration or chromatography.

Are there specific regulatory guidelines for the allowable levels of Isavuconazole Impurity 25 in pharmaceutical products?

Yes, regulatory bodies such as the FDA and EMA have guidelines for allowable levels of impurities in pharmaceuticals.

How can the presence of Isavuconazole Impurity 25 be detected and quantified in pharmaceutical products?

Analytical techniques such as HPLC or mass spectrometry can be used to detect and quantify the impurity in pharmaceutical products.

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry