0

Minapram impurity 4

INQUIRY Add to cart
For Research Use Only | Not For Clinical Use
CATAPB153275060
CAS153275-06-0
Molecular Weight173.22
Molecular FormulaC11H11NO

What is the product name of CAS 153275-06-0?

The product name is Minapram impurity 4.

What is the molecular weight of Minapram impurity 4?

The molecular weight is 173.22.

What is the molecular formula of Minapram impurity 4?

The molecular formula is C11H11NO.

What is the chemical structure of Minapram impurity 4?

The chemical structure is C-C-C-C-C-C-N(=O)-C-C-C-C.

How is Minapram impurity 4 classified in terms of its chemical composition?

It is classified as an organic compound.

How can the molecular formula of Minapram impurity 4 be used in chemical reactions or synthesis?

The molecular formula provides information on the number and type of atoms present in the compound, which is essential for predicting reaction outcomes.

Is Minapram impurity 4 a common or rare compound in the field of chemistry?

Without additional information, it is difficult to determine if Minapram impurity 4 is a common or rare compound.

  • Verification code

Online Inquiry

For any inquiry, question or recommendation, please call: or fill out the following form.

  • Verification code
Contact Us

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.
Online Inquiry
qrcode