0

Pomalidomide Impurity 21

INQUIRY Add to cart
For Research Use Only | Not For Clinical Use
CATAPB19171187
CAS19171-18-7
Molecular Weight303.23
Molecular FormulaC13H9N3O6

What is the product name for CAS 19171-18-7?

The product name is Pomalidomide Impurity 21.

What is the molecular weight of Pomalidomide Impurity 21?

The molecular weight is 303.23.

What is the molecular formula of Pomalidomide Impurity 21?

The molecular formula is C13H9N3O6.

What is the chemical structure of Pomalidomide Impurity 21?

The chemical structure is C6H4C(C1(=O)OC(C1=O)N)NN2C(=O)OCC2.

How is Pomalidomide Impurity 21 classified?

It is classified as an impurity of the drug pomalidomide.

What is the significance of CAS 19171-18-7?

It is the reference number for the compound Pomalidomide Impurity 21.

How is Pomalidomide Impurity 21 related to pomalidomide?

It is an impurity that can be present in the production or synthesis of the drug pomalidomide.

What are the potential effects of Pomalidomide Impurity 21?

The presence of impurities like Pomalidomide Impurity 21 can affect the purity and effectiveness of the drug pomalidomide.

How is Pomalidomide Impurity 21 produced?

It may be produced as a byproduct during the manufacturing process of pomalidomide.

How can Pomalidomide Impurity 21 be identified and quantified in samples?

It can be identified and quantified using analytical techniques such as chromatography and spectroscopy.

  • Verification code
Contact Us

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.
Online Inquiry

Online Inquiry

For any inquiry, question or recommendation, please call: or fill out the following form.

  • Verification code

Head Office

  • Tel:
  • Email:

Follow us on

qrcode