CAS 40321-98-0 rac Mono(2-ethyl-5-oxohexyl) Phthalate with the exact weight

CAT	APS40321980A
CAS	40321-98-0
Structure
IUPAC Name	2-(2-ethyl-5-oxohexoxy)carbonylbenzoic acid
Molecular Weight	292.33
Molecular Formula	C16H20O5
Canonical SMILES	CCC(CCC(=O)C)COC(=O)c1ccccc1C(=O)O
InChI	InChI=1S/C16H20O5/c1-3-12(9-8-11(2)17)10-21-16(20)14-7-5-4-6-13(14)15(18)19/h4-7,12H,3,8-10H2,1-2H3,(H,18,19)

* Products or Services Interested: rac Mono(2-ethyl-5-oxohexyl) Phthalate with the exact weight (40321-98-0)
* Your question
* Name
* Email
Verification Code

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry