CAS 40809-41-4 rac Mono(5-carboxy-2-ethylpentyl) Phthalate with the exact weight

CAT	APS40809414A
CAS	40809-41-4
Structure
IUPAC Name	2-(5-carboxy-2-ethylpentoxy)carbonylbenzoic acid
Molecular Weight	308.33
Molecular Formula	C16H20O6
Canonical SMILES	CCC(CCCC(=O)O)COC(=O)c1ccccc1C(=O)O
InChI	InChI=1S/C16H20O6/c1-2-11(6-5-9-14(17)18)10-22-16(21)13-8-4-3-7-12(13)15(19)20/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,17,18)(H,19,20)

* Products or Services Interested: rac Mono(5-carboxy-2-ethylpentyl) Phthalate with the exact weight (40809-41-4)
* Your question
* Name
* Email
Verification Code

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry