Mesalazine Impurity 28

INQUIRY Add to cart

For Research Use Only | Not For Clinical Use

CAT	APB93968811
CAS	93968-81-1
Molecular Weight	223.23
Molecular Formula	C11H13NO4

What is the product name of CAS 93968-81-1?

The product name is Mesalazine Impurity 28.

What is the molecular weight of Mesalazine Impurity 28?

The molecular weight is 223.23.

What is the molecular formula of Mesalazine Impurity 28?

The molecular formula is C11H13NO4.

What is the chemical structure of Mesalazine Impurity 28?

The chemical structure is C-C-C-C-C-C-N-C-C-C(O)=O.

What role does Mesalazine Impurity 28 play in pharmaceuticals?

Mesalazine Impurity 28 is a known impurity in mesalazine, a medication used for the treatment of inflammatory bowel disease.

How is Mesalazine Impurity 28 synthesized?

Mesalazine Impurity 28 can be synthesized through organic chemistry techniques involving the reaction of specific starting materials.

Why is it important to detect and quantify Mesalazine Impurity 28 in pharmaceutical formulations?

The presence of impurities like Mesalazine Impurity 28 can affect the efficacy and safety of pharmaceutical products, so it is crucial to monitor and control their levels.

What analytical techniques can be used to identify Mesalazine Impurity 28?

Techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry can be employed to detect and quantify Mesalazine Impurity 28.

What are some potential health risks associated with the presence of Mesalazine Impurity 28 in pharmaceuticals?

If levels of Mesalazine Impurity 28 are too high in pharmaceutical formulations, there may be potential negative health effects on patients taking the medication.

How can pharmaceutical companies ensure that levels of Mesalazine Impurity 28 are within acceptable limits in their products?

Pharmaceutical companies can implement strict quality control measures and monitoring processes to ensure that levels of Mesalazine Impurity 28 remain within acceptable limits in their products.

* Products or Services Interested: Mesalazine Impurity 28 (93968-81-1)
* Your question
* Name
* Email
Verification Code

Send Us a Request

What is your specific need? We will do everything we can to meet your expectations.

Online Inquiry